About 2-bromo-3,4,5,6-tetramethyloxane
2-bromo-3,4,5,6-tetramethyloxane (PubChem CID 20588382) has the molecular formula C9H17BrO
and a molecular weight of 221.14 g/mol. Its IUPAC name is 2-bromo-3,4,5,6-tetramethyloxane.
Molecular Properties
| Compound Name | 2-bromo-3,4,5,6-tetramethyloxane |
| PubChem CID | 20588382 |
| Molecular Formula | C9H17BrO |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-bromo-3,4,5,6-tetramethyloxane |
| SMILES | CC1OC(Br)C(C)C(C)C1C |
| InChI | InChI=1S/C9H17BrO/c1-5-6(2)8(4)11-9(10)7(5)3/h5-9H,1-4H3 |
| InChIKey | QCMJJUWYQRBJTK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,4,5,6-tetramethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,4,5,6-tetramethyloxane?
The IUPAC name of 2-bromo-3,4,5,6-tetramethyloxane (CID 20588382) is 2-bromo-3,4,5,6-tetramethyloxane.
What is the SMILES notation for 2-bromo-3,4,5,6-tetramethyloxane?
The canonical SMILES for 2-bromo-3,4,5,6-tetramethyloxane is CC1OC(Br)C(C)C(C)C1C.
What is the InChIKey of 2-bromo-3,4,5,6-tetramethyloxane?
The InChIKey is QCMJJUWYQRBJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrO/c1-5-6(2)8(4)11-9(10)7(5)3/h5-9H,1-4H3.
What are the key properties of 2-bromo-3,4,5,6-tetramethyloxane?
2-bromo-3,4,5,6-tetramethyloxane has a molecular weight of 221.14 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4,5,6-tetramethyloxane is sourced from PubChem (CID 20588382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).