About actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone
actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone (PubChem CID 20588387) has the molecular formula C9H15AcO3-
and a molecular weight of 398.22 g/mol. Its IUPAC name is actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone.
Molecular Properties
| Compound Name | actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone |
| PubChem CID | 20588387 |
| Molecular Formula | C9H15AcO3- |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone |
| SMILES | CC1OC([C-]=O)C(O)C(C)C1C.[Ac] |
| InChI | InChI=1S/C9H15O3.Ac/c1-5-6(2)9(11)8(4-10)12-7(5)3;/h5-9,11H,1-3H3;/q-1; |
| InChIKey | AHNGXODFUZLSBR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone?
The IUPAC name of actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone (CID 20588387) is actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone.
What is the SMILES notation for actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone?
The canonical SMILES for actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone is CC1OC([C-]=O)C(O)C(C)C1C.[Ac].
What is the InChIKey of actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone?
The InChIKey is AHNGXODFUZLSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O3.Ac/c1-5-6(2)9(11)8(4-10)12-7(5)3;/h5-9,11H,1-3H3;/q-1;.
What are the key properties of actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone?
actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone has a molecular weight of 398.22 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;(3-hydroxy-4,5,6-trimethyloxan-2-yl)methanone is sourced from PubChem (CID 20588387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).