C11H14N2O2 — CID 20588416
7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 20588416) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 20588416 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CN1Cc2cc(N)ccc2CC1C(=O)O |
| InChI | InChI=1S/C11H14N2O2/c1-13-6-8-4-9(12)3-2-7(8)5-10(13)11(14)15/h2-4,10H,5-6,12H2,1H3,(H,14,15) |
| InChIKey | FZRZEASPDXYMQF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|