About 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid
7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 20588416) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| PubChem CID | 20588416 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CN1Cc2cc(N)ccc2CC1C(=O)O |
| InChI | InChI=1S/C11H14N2O2/c1-13-6-8-4-9(12)3-2-7(8)5-10(13)11(14)15/h2-4,10H,5-6,12H2,1H3,(H,14,15) |
| InChIKey | FZRZEASPDXYMQF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
The IUPAC name of 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CID 20588416) is 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
What is the SMILES notation for 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
The canonical SMILES for 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid is CN1Cc2cc(N)ccc2CC1C(=O)O.
What is the InChIKey of 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
The InChIKey is FZRZEASPDXYMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-13-6-8-4-9(12)3-2-7(8)5-10(13)11(14)15/h2-4,10H,5-6,12H2,1H3,(H,14,15).
What are the key properties of 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid has a molecular weight of 206.25 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid is sourced from PubChem (CID 20588416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).