C29H28O7 — CID 20588619
[2-[4-(4-methylbenzoyl)oxyphenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzoate (PubChem CID 20588619) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is [2-[4-(4-methylbenzoyl)oxyphenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzoate.
| Compound Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20588619 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C3OCC4OCCC(OC(=O)c5ccc(C)cc5)C4O3)cc2)cc1 |
| InChI | InChI=1S/C29H28O7/c1-18-3-7-20(8-4-18)27(30)34-23-13-11-22(12-14-23)29-33-17-25-26(36-29)24(15-16-32-25)35-28(31)21-9-5-19(2)6-10-21/h3-14,24-26,29H,15-17H2,1-2H3 |
| InChIKey | URPNJXGXUUYBCV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|