About 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene
4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene (PubChem CID 20588997) has the molecular formula C12H23Br
and a molecular weight of 247.22 g/mol. Its IUPAC name is 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene.
Molecular Properties
| Compound Name | 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene |
| PubChem CID | 20588997 |
| Molecular Formula | C12H23Br |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene |
| SMILES | C=CCC(C)(C(C)(C)C)C(C)(C)Br |
| InChI | InChI=1S/C12H23Br/c1-8-9-12(7,10(2,3)4)11(5,6)13/h8H,1,9H2,2-7H3 |
| InChIKey | KQJZPIVFCLICCV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene?
The IUPAC name of 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene (CID 20588997) is 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene.
What is the SMILES notation for 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene?
The canonical SMILES for 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene is C=CCC(C)(C(C)(C)C)C(C)(C)Br.
What is the InChIKey of 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene?
The InChIKey is KQJZPIVFCLICCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23Br/c1-8-9-12(7,10(2,3)4)11(5,6)13/h8H,1,9H2,2-7H3.
What are the key properties of 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene?
4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene has a molecular weight of 247.22 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromopropan-2-yl)-4,5,5-trimethylhex-1-ene is sourced from PubChem (CID 20588997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).