About 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one
5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one (PubChem CID 20589004) has the molecular formula C9H19N3O3
and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one.
Molecular Properties
| Compound Name | 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one |
| PubChem CID | 20589004 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one |
| SMILES | CCN1CN(COC)C(=O)N(COC)C1 |
| InChI | InChI=1S/C9H19N3O3/c1-4-10-5-11(7-14-2)9(13)12(6-10)8-15-3/h4-8H2,1-3H3 |
| InChIKey | GTJBADKKFDEUJQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one?
The IUPAC name of 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one (CID 20589004) is 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one.
What is the SMILES notation for 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one?
The canonical SMILES for 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one is CCN1CN(COC)C(=O)N(COC)C1.
What is the InChIKey of 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one?
The InChIKey is GTJBADKKFDEUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O3/c1-4-10-5-11(7-14-2)9(13)12(6-10)8-15-3/h4-8H2,1-3H3.
What are the key properties of 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one?
5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one has a molecular weight of 217.27 g/mol, XLogP of 0.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-bis(methoxymethyl)-1,3,5-triazinan-2-one is sourced from PubChem (CID 20589004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).