About CID 20589046
CID 20589046 (PubChem CID 20589046) has the molecular formula C40H75O11Si4
and a molecular weight of 844.37 g/mol.
Molecular Properties
| Compound Name | CID 20589046 |
| PubChem CID | 20589046 |
| Molecular Formula | C40H75O11Si4 |
| Molecular Weight | 844.37 g/mol |
| Exact Mass | 843.44 |
| IUPAC Name | — |
| SMILES | CCC(C)C(=O)OCC(C)(C)COC(=O)C(CC)CC(C)(CC(C)(CC(C)C(=O)OCCO[Si]1(C)C[Si](C)C[Si](C)C[Si](C)C1)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C40H75O11Si4/c1-16-29(3)32(41)48-23-38(8,9)24-49-34(43)31(17-2)21-39(10,35(44)45)22-40(11,36(46)51-37(5,6)7)20-30(4)33(42)47-18-19-50-55(15)27-53(13)25-52(12)26-54(14)28-55/h29-31H,16-28H2,1-15H3,(H,44,45) |
| InChIKey | QGNUDUPECWCQKU-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 844.37 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20589046 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20589046?
The IUPAC name of CID 20589046 (CID 20589046) is not available.
What is the SMILES notation for CID 20589046?
The canonical SMILES for CID 20589046 is CCC(C)C(=O)OCC(C)(C)COC(=O)C(CC)CC(C)(CC(C)(CC(C)C(=O)OCCO[Si]1(C)C[Si](C)C[Si](C)C[Si](C)C1)C(=O)OC(C)(C)C)C(=O)O.
What is the InChIKey of CID 20589046?
The InChIKey is QGNUDUPECWCQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H75O11Si4/c1-16-29(3)32(41)48-23-38(8,9)24-49-34(43)31(17-2)21-39(10,35(44)45)22-40(11,36(46)51-37(5,6)7)20-30(4)33(42)47-18-19-50-55(15)27-53(13)25-52(12)26-54(14)28-55/h29-31H,16-28H2,1-15H3,(H,44,45).
What are the key properties of CID 20589046?
CID 20589046 has a molecular weight of 844.37 g/mol, XLogP of 8.10, 21 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20589046 is sourced from PubChem (CID 20589046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).