C20H32N2O2 — CID 20589072
2-N,2-N,3-N,3-N-tetraethyl-1,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide (PubChem CID 20589072) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-N,2-N,3-N,3-N-tetraethyl-1,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide.
| Compound Name | 2-N,2-N,3-N,3-N-tetraethyl-1,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 20589072 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 2-N,2-N,3-N,3-N-tetraethyl-1,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C(=O)N(CC)CC)C2(C)C(C)=C(C)C12C |
| InChI | InChI=1S/C20H32N2O2/c1-9-21(10-2)17(23)15-16(18(24)22(11-3)12-4)20(8)14(6)13(5)19(15,20)7/h9-12H2,1-8H3 |
| InChIKey | SRASUOHMHRQVQJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|