C16H19N3O2S2 — CID 20589079
1,3-diethyl-5-(3-methyl-2H-1,3-benzothiazol-2-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 20589079) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1,3-diethyl-5-(3-methyl-2H-1,3-benzothiazol-2-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-diethyl-5-(3-methyl-2H-1,3-benzothiazol-2-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 20589079 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1,3-diethyl-5-(3-methyl-2H-1,3-benzothiazol-2-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(C2Sc3ccccc3N2C)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C16H19N3O2S2/c1-4-18-13(20)12(14(21)19(5-2)16(18)22)15-17(3)10-8-6-7-9-11(10)23-15/h6-9,12,15H,4-5H2,1-3H3 |
| InChIKey | VUOBKNIPKHWNJC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|