C39H33ClN4O7S — CID 20589221
[1-(2-chloro-4-methylsulfonylanilino)-1,3-dioxo-3-phenylpropan-2-yl] N-[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-3-methylphenyl]-N-cyclopentylcarbamate (PubChem CID 20589221) has the molecular formula C39H33ClN4O7S and a molecular weight of 737.23 g/mol. Its IUPAC name is [1-(2-chloro-4-methylsulfonylanilino)-1,3-dioxo-3-phenylpropan-2-yl] N-[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-3-methylphenyl]-N-cyclopentylcarbamate.
| Compound Name | [1-(2-chloro-4-methylsulfonylanilino)-1,3-dioxo-3-phenylpropan-2-yl] N-[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-3-methylphenyl]-N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 20589221 |
| Molecular Formula | C39H33ClN4O7S |
| Molecular Weight | 737.23 g/mol |
| Exact Mass | 736.18 |
| IUPAC Name | [1-(2-chloro-4-methylsulfonylanilino)-1,3-dioxo-3-phenylpropan-2-yl] N-[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-3-methylphenyl]-N-cyclopentylcarbamate |
| SMILES | Cc1cc(N(C(=O)OC(C(=O)Nc2ccc(S(C)(=O)=O)cc2Cl)C(=O)c2ccccc2)C2CCCC2)ccc1/C=C(\C#N)c1nc2ccccc2o1 |
| InChI | InChI=1S/C39H33ClN4O7S/c1-24-20-29(17-16-26(24)21-27(23-41)38-43-33-14-8-9-15-34(33)50-38)44(28-12-6-7-13-28)39(47)51-36(35(45)25-10-4-3-5-11-25)37(46)42-32-19-18-30(22-31(32)40)52(2,48)49/h3-5,8-11,14-22,28,36H,6-7,12-13H2,1-2H3,(H,42,46)/b27-21+ |
| InChIKey | MGZRYNIZECBJAT-SZXQPVLSSA-N |
| XLogP | 8.03 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.23 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|