About 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one
1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one (PubChem CID 20589679) has the molecular formula C12H22N2O3S
and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one.
Molecular Properties
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one |
| PubChem CID | 20589679 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one |
| SMILES | CNC1CCCCN(CC2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C12H22N2O3S/c1-13-11-4-2-3-6-14(12(11)15)8-10-5-7-18(16,17)9-10/h10-11,13H,2-9H2,1H3 |
| InChIKey | OOTXXWJKKWTLKA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one?
The IUPAC name of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one (CID 20589679) is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one.
What is the SMILES notation for 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one?
The canonical SMILES for 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one is CNC1CCCCN(CC2CCS(=O)(=O)C2)C1=O.
What is the InChIKey of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one?
The InChIKey is OOTXXWJKKWTLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3S/c1-13-11-4-2-3-6-14(12(11)15)8-10-5-7-18(16,17)9-10/h10-11,13H,2-9H2,1H3.
What are the key properties of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one?
1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one has a molecular weight of 274.39 g/mol, XLogP of 0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(methylamino)azepan-2-one is sourced from PubChem (CID 20589679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).