C11H16N2OS — CID 20589809
3-(methylamino)-1-thiophen-3-ylazepan-2-one (PubChem CID 20589809) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 3-(methylamino)-1-thiophen-3-ylazepan-2-one.
| Compound Name | 3-(methylamino)-1-thiophen-3-ylazepan-2-one |
|---|---|
| PubChem CID | 20589809 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-(methylamino)-1-thiophen-3-ylazepan-2-one |
| SMILES | CNC1CCCCN(c2ccsc2)C1=O |
| InChI | InChI=1S/C11H16N2OS/c1-12-10-4-2-3-6-13(11(10)14)9-5-7-15-8-9/h5,7-8,10,12H,2-4,6H2,1H3 |
| InChIKey | FJUJAZBFHCQRTJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |