C16H21FN2O — CID 2059012
4-[5-(2-fluorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 2059012) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is 4-[5-(2-fluorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-[5-(2-fluorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 2059012 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-[5-(2-fluorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CCCCCOc1ccccc1F |
| InChI | InChI=1S/C16H21FN2O/c1-12-14(13(2)19-18-12)8-4-3-7-11-20-16-10-6-5-9-15(16)17/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,18,19) |
| InChIKey | YZZKYRVOMDNYLU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|