About 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one
6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one (PubChem CID 20590160) has the molecular formula C9H18N2O3S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one |
| PubChem CID | 20590160 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one |
| SMILES | CCCN1CCS(=O)(=O)CC(NC)C1=O |
| InChI | InChI=1S/C9H18N2O3S/c1-3-4-11-5-6-15(13,14)7-8(10-2)9(11)12/h8,10H,3-7H2,1-2H3 |
| InChIKey | TWDXHAGWNIPXSI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one?
The IUPAC name of 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one (CID 20590160) is 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one.
What is the SMILES notation for 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one?
The canonical SMILES for 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one is CCCN1CCS(=O)(=O)CC(NC)C1=O.
What is the InChIKey of 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one?
The InChIKey is TWDXHAGWNIPXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3S/c1-3-4-11-5-6-15(13,14)7-8(10-2)9(11)12/h8,10H,3-7H2,1-2H3.
What are the key properties of 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one?
6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one has a molecular weight of 234.32 g/mol, XLogP of -0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylamino)-1,1-dioxo-4-propyl-1,4-thiazepan-5-one is sourced from PubChem (CID 20590160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).