About 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one
6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one (PubChem CID 20590191) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one.
Molecular Properties
| Compound Name | 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one |
| PubChem CID | 20590191 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one |
| SMILES | CNC1COCCN(Cc2ncco2)C1=O |
| InChI | InChI=1S/C10H15N3O3/c1-11-8-7-15-5-3-13(10(8)14)6-9-12-2-4-16-9/h2,4,8,11H,3,5-7H2,1H3 |
| InChIKey | ISZWHWGDGISJOR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one?
The IUPAC name of 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one (CID 20590191) is 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one.
What is the SMILES notation for 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one?
The canonical SMILES for 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one is CNC1COCCN(Cc2ncco2)C1=O.
What is the InChIKey of 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one?
The InChIKey is ISZWHWGDGISJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-11-8-7-15-5-3-13(10(8)14)6-9-12-2-4-16-9/h2,4,8,11H,3,5-7H2,1H3.
What are the key properties of 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one?
6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one has a molecular weight of 225.25 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylamino)-4-(1,3-oxazol-2-ylmethyl)-1,4-oxazepan-5-one is sourced from PubChem (CID 20590191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).