C25H17Cl2F9O3 — CID 20590779
7,7-bis[3-chloro-4-methyl-5-(2,2,2-trifluoroacetyl)phenyl]-1,1,1-trifluorohept-6-en-2-one (PubChem CID 20590779) has the molecular formula C25H17Cl2F9O3 and a molecular weight of 607.30 g/mol. Its IUPAC name is 7,7-bis[3-chloro-4-methyl-5-(2,2,2-trifluoroacetyl)phenyl]-1,1,1-trifluorohept-6-en-2-one.
| Compound Name | 7,7-bis[3-chloro-4-methyl-5-(2,2,2-trifluoroacetyl)phenyl]-1,1,1-trifluorohept-6-en-2-one |
|---|---|
| PubChem CID | 20590779 |
| Molecular Formula | C25H17Cl2F9O3 |
| Molecular Weight | 607.30 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | 7,7-bis[3-chloro-4-methyl-5-(2,2,2-trifluoroacetyl)phenyl]-1,1,1-trifluorohept-6-en-2-one |
| SMILES | Cc1c(Cl)cc(C(=CCCCC(=O)C(F)(F)F)c2cc(Cl)c(C)c(C(=O)C(F)(F)F)c2)cc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C25H17Cl2F9O3/c1-11-16(21(38)24(31,32)33)7-13(9-18(11)26)15(5-3-4-6-20(37)23(28,29)30)14-8-17(12(2)19(27)10-14)22(39)25(34,35)36/h5,7-10H,3-4,6H2,1-2H3 |
| InChIKey | JZGKDHQHBKMCII-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.30 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|