About CID 20591149
CID 20591149 (PubChem CID 20591149) has the molecular formula C12H23BSi
and a molecular weight of 206.21 g/mol.
Molecular Properties
| Compound Name | CID 20591149 |
| PubChem CID | 20591149 |
| Molecular Formula | C12H23BSi |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | — |
| SMILES | C[Si]CCCB1C2CCCC1CCC2 |
| InChI | InChI=1S/C12H23BSi/c1-14-10-4-9-13-11-5-2-6-12(13)8-3-7-11/h11-12H,2-10H2,1H3 |
| InChIKey | IIMIKYSDNINSHP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20591149 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20591149?
The IUPAC name of CID 20591149 (CID 20591149) is not available.
What is the SMILES notation for CID 20591149?
The canonical SMILES for CID 20591149 is C[Si]CCCB1C2CCCC1CCC2.
What is the InChIKey of CID 20591149?
The InChIKey is IIMIKYSDNINSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BSi/c1-14-10-4-9-13-11-5-2-6-12(13)8-3-7-11/h11-12H,2-10H2,1H3.
What are the key properties of CID 20591149?
CID 20591149 has a molecular weight of 206.21 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20591149 is sourced from PubChem (CID 20591149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).