C35H43N8O6S+ — CID 20591446
1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-[6-(pyridin-3-ylmethoxyamino)hexyl]pyridin-1-ium-3-carboxamide (PubChem CID 20591446) has the molecular formula C35H43N8O6S+ and a molecular weight of 703.85 g/mol. Its IUPAC name is 1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-[6-(pyridin-3-ylmethoxyamino)hexyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-[6-(pyridin-3-ylmethoxyamino)hexyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 20591446 |
| Molecular Formula | C35H43N8O6S+ |
| Molecular Weight | 703.85 g/mol |
| Exact Mass | 703.30 |
| IUPAC Name | 1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]-N-[6-(pyridin-3-ylmethoxyamino)hexyl]pyridin-1-ium-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NNC=O)cc2)c(C)c1NC(=O)C[n+]1cccc(C(=O)NCCCCCCNOCc2cccnc2)c1 |
| InChI | InChI=1S/C35H42N8O6S/c1-26-11-16-32(50(47,48)42-31-14-12-30(13-15-31)41-38-25-44)27(2)34(26)40-33(45)23-43-20-8-10-29(22-43)35(46)37-18-5-3-4-6-19-39-49-24-28-9-7-17-36-21-28/h7-17,20-22,25,39,41-42H,3-6,18-19,23-24H2,1-2H3,(H2-,37,38,40,44,45,46)/p+1 |
| InChIKey | GRPNQMXHNRVYDU-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 183.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|