C29H35N7O6S — CID 20591476
N-[2,6-dimethyl-3-[[4-[2-[2-(3-morpholin-4-ylpropylamino)-2-oxoacetyl]hydrazinyl]phenyl]sulfamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 20591476) has the molecular formula C29H35N7O6S and a molecular weight of 609.71 g/mol. Its IUPAC name is N-[2,6-dimethyl-3-[[4-[2-[2-(3-morpholin-4-ylpropylamino)-2-oxoacetyl]hydrazinyl]phenyl]sulfamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2,6-dimethyl-3-[[4-[2-[2-(3-morpholin-4-ylpropylamino)-2-oxoacetyl]hydrazinyl]phenyl]sulfamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 20591476 |
| Molecular Formula | C29H35N7O6S |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | N-[2,6-dimethyl-3-[[4-[2-[2-(3-morpholin-4-ylpropylamino)-2-oxoacetyl]hydrazinyl]phenyl]sulfamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NNC(=O)C(=O)NCCCN3CCOCC3)cc2)c(C)c1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C29H35N7O6S/c1-20-6-11-25(21(2)26(20)32-27(37)22-5-3-12-30-19-22)43(40,41)35-24-9-7-23(8-10-24)33-34-29(39)28(38)31-13-4-14-36-15-17-42-18-16-36/h3,5-12,19,33,35H,4,13-18H2,1-2H3,(H,31,38)(H,32,37)(H,34,39) |
| InChIKey | IGDPIILAPHJPFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 170.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|