C22H36O9 — CID 20591735
2-ethyl-7-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-4-methoxycarbonyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid (PubChem CID 20591735) has the molecular formula C22H36O9 and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-ethyl-7-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-4-methoxycarbonyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid.
| Compound Name | 2-ethyl-7-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-4-methoxycarbonyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 20591735 |
| Molecular Formula | C22H36O9 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-ethyl-7-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-4-methoxycarbonyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C22H36O9/c1-9-21(6,17(25)26)13-22(7,19(28)29-8)12-20(4,5)18(27)31-11-15(23)10-30-16(24)14(2)3/h15,23H,2,9-13H2,1,3-8H3,(H,25,26) |
| InChIKey | AMLCVJZBZLYURA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|