About (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate
(2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate (PubChem CID 20591766) has the molecular formula C31H45NO3
and a molecular weight of 479.71 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate.
Molecular Properties
| Compound Name | (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate |
| PubChem CID | 20591766 |
| Molecular Formula | C31H45NO3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate |
| SMILES | CCC(C)(C#N)CC(C)(CC(C)(C)c1ccc(O)cc1)C(=O)OC1(CC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C31H45NO3/c1-7-29(5,20-32)19-30(6,18-28(3,4)23-9-11-26(33)12-10-23)27(34)35-31(8-2)24-14-21-13-22(16-24)17-25(31)15-21/h9-12,21-22,24-25,33H,7-8,13-19H2,1-6H3 |
| InChIKey | NKMOSYBENJFDFV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate?
The IUPAC name of (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate (CID 20591766) is (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate.
What is the SMILES notation for (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate?
The canonical SMILES for (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate is CCC(C)(C#N)CC(C)(CC(C)(C)c1ccc(O)cc1)C(=O)OC1(CC)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate?
The InChIKey is NKMOSYBENJFDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H45NO3/c1-7-29(5,20-32)19-30(6,18-28(3,4)23-9-11-26(33)12-10-23)27(34)35-31(8-2)24-14-21-13-22(16-24)17-25(31)15-21/h9-12,21-22,24-25,33H,7-8,13-19H2,1-6H3.
What are the key properties of (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate?
(2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate has a molecular weight of 479.71 g/mol, XLogP of 7.54, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-2-adamantyl) 4-cyano-2-[2-(4-hydroxyphenyl)-2-methylpropyl]-2,4-dimethylhexanoate is sourced from PubChem (CID 20591766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).