C4H14O14P6 — CID 20591809
2,4,6,8,10,12-hexahydroxy-1,7-dioxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododecane 2,4,6,8,10,12-hexaoxide (PubChem CID 20591809) has the molecular formula C4H14O14P6 and a molecular weight of 471.99 g/mol. Its IUPAC name is 2,4,6,8,10,12-hexahydroxy-1,7-dioxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododecane 2,4,6,8,10,12-hexaoxide.
| Compound Name | 2,4,6,8,10,12-hexahydroxy-1,7-dioxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododecane 2,4,6,8,10,12-hexaoxide |
|---|---|
| PubChem CID | 20591809 |
| Molecular Formula | C4H14O14P6 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.88 |
| IUPAC Name | 2,4,6,8,10,12-hexahydroxy-1,7-dioxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododecane 2,4,6,8,10,12-hexaoxide |
| SMILES | O=P1(O)CP(=O)(O)OP(=O)(O)CP(=O)(O)CP(=O)(O)OP(=O)(O)C1 |
| InChI | InChI=1S/C4H14O14P6/c5-19(6)1-21(9,10)17-23(13,14)3-20(7,8)4-24(15,16)18-22(11,12)2-19/h1-4H2,(H,5,6)(H,7,8)(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | AXDVBYLJGBCONJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|