About 2,4-dioxopentanedial
2,4-dioxopentanedial (PubChem CID 20591840) has the molecular formula C5H4O4
and a molecular weight of 128.08 g/mol. Its IUPAC name is 2,4-dioxopentanedial.
Molecular Properties
| Compound Name | 2,4-dioxopentanedial |
| PubChem CID | 20591840 |
| Molecular Formula | C5H4O4 |
| Molecular Weight | 128.08 g/mol |
| Exact Mass | 128.01 |
| IUPAC Name | 2,4-dioxopentanedial |
| SMILES | O=CC(=O)CC(=O)C=O |
| InChI | InChI=1S/C5H4O4/c6-2-4(8)1-5(9)3-7/h2-3H,1H2 |
| InChIKey | KUJUZIXUQKRHJJ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.08 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dioxopentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxopentanedial?
The IUPAC name of 2,4-dioxopentanedial (CID 20591840) is 2,4-dioxopentanedial.
What is the SMILES notation for 2,4-dioxopentanedial?
The canonical SMILES for 2,4-dioxopentanedial is O=CC(=O)CC(=O)C=O.
What is the InChIKey of 2,4-dioxopentanedial?
The InChIKey is KUJUZIXUQKRHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O4/c6-2-4(8)1-5(9)3-7/h2-3H,1H2.
What are the key properties of 2,4-dioxopentanedial?
2,4-dioxopentanedial has a molecular weight of 128.08 g/mol, XLogP of -1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxopentanedial is sourced from PubChem (CID 20591840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).