C13H28N2O2+2 — CID 2059216
2-[2-[4-[(Z)-2-methylbut-2-enyl]piperazine-1,4-diium-1-yl]ethoxy]ethanol (PubChem CID 2059216) has the molecular formula C13H28N2O2+2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-[2-[4-[(Z)-2-methylbut-2-enyl]piperazine-1,4-diium-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[(Z)-2-methylbut-2-enyl]piperazine-1,4-diium-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 2059216 |
| Molecular Formula | C13H28N2O2+2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | 2-[2-[4-[(Z)-2-methylbut-2-enyl]piperazine-1,4-diium-1-yl]ethoxy]ethanol |
| SMILES | C/C=C(/C)C[NH+]1CC[NH+](CCOCCO)CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-3-13(2)12-15-6-4-14(5-7-15)8-10-17-11-9-16/h3,16H,4-12H2,1-2H3/p+2/b13-3- |
| InChIKey | NXGFINPBPPTYPN-DXNYSGJVSA-P |
| XLogP | -2.26 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|