About 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one
4-propanoyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 20592810) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 20592810 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCC(=O)C1CCC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H14O2/c1-2-12(14)11-7-8-13(15)10-6-4-3-5-9(10)11/h3-6,11H,2,7-8H2,1H3 |
| InChIKey | BFLNINMQTSACMG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one (CID 20592810) is 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one is CCC(=O)C1CCC(=O)c2ccccc21.
What is the InChIKey of 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is BFLNINMQTSACMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-2-12(14)11-7-8-13(15)10-6-4-3-5-9(10)11/h3-6,11H,2,7-8H2,1H3.
What are the key properties of 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one?
4-propanoyl-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 202.25 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propanoyl-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 20592810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).