C17H14N2S — CID 2059289
3-(4-phenylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 2059289) has the molecular formula C17H14N2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-(4-phenylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 2059289 |
| Molecular Formula | C17H14N2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-(4-phenylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | C1=C(c2ccc(-c3ccccc3)cc2)N2CCN=C2S1 |
| InChI | InChI=1S/C17H14N2S/c1-2-4-13(5-3-1)14-6-8-15(9-7-14)16-12-20-17-18-10-11-19(16)17/h1-9,12H,10-11H2 |
| InChIKey | LUVTZCJMWMYVRO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |