C33H38O4S — CID 20592940
4-[2-(6a,10b-dimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)-1-phenylsulfanylethyl]-2H-furan-5-one (PubChem CID 20592940) has the molecular formula C33H38O4S and a molecular weight of 530.73 g/mol. Its IUPAC name is 4-[2-(6a,10b-dimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)-1-phenylsulfanylethyl]-2H-furan-5-one.
| Compound Name | 4-[2-(6a,10b-dimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)-1-phenylsulfanylethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 20592940 |
| Molecular Formula | C33H38O4S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 4-[2-(6a,10b-dimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)-1-phenylsulfanylethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2C3(C)COC(c4ccccc4)OC3CCC2(C)C1CC(Sc1ccccc1)C1=CCOC1=O |
| InChI | InChI=1S/C33H38O4S/c1-22-14-15-28-32(2,18-16-29-33(28,3)21-36-31(37-29)23-10-6-4-7-11-23)26(22)20-27(25-17-19-35-30(25)34)38-24-12-8-5-9-13-24/h4-13,17,26-29,31H,1,14-16,18-21H2,2-3H3 |
| InChIKey | VIKHDTCBMJMZSC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|