C21H31N3O6 — CID 20593286
6-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)oxycarbonylamino]hexyl N-(2-methylpropyl)carbamate (PubChem CID 20593286) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is 6-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)oxycarbonylamino]hexyl N-(2-methylpropyl)carbamate.
| Compound Name | 6-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)oxycarbonylamino]hexyl N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 20593286 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 6-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)oxycarbonylamino]hexyl N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CNC(=O)OCCCCCCNC(=O)ON1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C21H31N3O6/c1-13(2)12-23-20(27)29-10-6-4-3-5-9-22-21(28)30-24-18(25)16-14-7-8-15(11-14)17(16)19(24)26/h7-8,13-17H,3-6,9-12H2,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | KOUASVOGFPTOEG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|