C19H38O3Si — CID 20593572
2-[(1S,5S)-5-(2-trimethylsilylethoxymethoxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol (PubChem CID 20593572) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is 2-[(1S,5S)-5-(2-trimethylsilylethoxymethoxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol.
| Compound Name | 2-[(1S,5S)-5-(2-trimethylsilylethoxymethoxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 20593572 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-[(1S,5S)-5-(2-trimethylsilylethoxymethoxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CCCC2C1CCC[C@@H]2OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-19(2,20)17-10-6-9-16-15(17)8-7-11-18(16)22-14-21-12-13-23(3,4)5/h15-18,20H,6-14H2,1-5H3/t15?,16?,17-,18-/m0/s1 |
| InChIKey | IKNZODBQKKJAOF-FOIPXRHGSA-N |
| XLogP | 4.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|