About 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium)
1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) (PubChem CID 20593650) has the molecular formula C8H8Y11-2
and a molecular weight of 1082.12 g/mol. Its IUPAC name is 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium).
Molecular Properties
| Compound Name | 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) |
| PubChem CID | 20593650 |
| Molecular Formula | C8H8Y11-2 |
| Molecular Weight | 1082.12 g/mol |
| Exact Mass | 1082.03 |
| IUPAC Name | 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) |
| SMILES | Cc1[c-]cc(C)c[c-]1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C8H8.11Y/c1-7-3-5-8(2)6-4-7;;;;;;;;;;;/h3-4H,1-2H3;;;;;;;;;;;/q-2;;;;;;;;;;; |
| InChIKey | UGTXJIMNSJXJEL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1082.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium)?
The IUPAC name of 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) (CID 20593650) is 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium).
What is the SMILES notation for 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium)?
The canonical SMILES for 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) is Cc1[c-]cc(C)c[c-]1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium)?
The InChIKey is UGTXJIMNSJXJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.11Y/c1-7-3-5-8(2)6-4-7;;;;;;;;;;;/h3-4H,1-2H3;;;;;;;;;;;/q-2;;;;;;;;;;;.
What are the key properties of 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium)?
1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) has a molecular weight of 1082.12 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylbenzene-3,5-diide;undecakis(yttrium) is sourced from PubChem (CID 20593650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).