About (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate
(2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate (PubChem CID 20593692) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate |
| PubChem CID | 20593692 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate |
| SMILES | CC1C2CC(C(O)CC(=O)OC3CCOC3=O)C(C2)C1C |
| InChI | InChI=1S/C16H24O5/c1-8-9(2)11-5-10(8)6-12(11)13(17)7-15(18)21-14-3-4-20-16(14)19/h8-14,17H,3-7H2,1-2H3 |
| InChIKey | ZRVGMNKIEUNEQL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate?
The IUPAC name of (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate (CID 20593692) is (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate?
The canonical SMILES for (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate is CC1C2CC(C(O)CC(=O)OC3CCOC3=O)C(C2)C1C.
What is the InChIKey of (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate?
The InChIKey is ZRVGMNKIEUNEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O5/c1-8-9(2)11-5-10(8)6-12(11)13(17)7-15(18)21-14-3-4-20-16(14)19/h8-14,17H,3-7H2,1-2H3.
What are the key properties of (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate?
(2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate has a molecular weight of 296.36 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-3-hydroxypropanoate is sourced from PubChem (CID 20593692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).