About 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one
3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one (PubChem CID 20593703) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one.
Molecular Properties
| Compound Name | 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one |
| PubChem CID | 20593703 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one |
| SMILES | CC1C2CC(CC3CCOC3=O)C(C2)C1C |
| InChI | InChI=1S/C14H22O2/c1-8-9(2)13-7-11(8)6-12(13)5-10-3-4-16-14(10)15/h8-13H,3-7H2,1-2H3 |
| InChIKey | WVCCCGHZHPQNON-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one?
The IUPAC name of 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one (CID 20593703) is 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one.
What is the SMILES notation for 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one?
The canonical SMILES for 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one is CC1C2CC(CC3CCOC3=O)C(C2)C1C.
What is the InChIKey of 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one?
The InChIKey is WVCCCGHZHPQNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-8-9(2)13-7-11(8)6-12(13)5-10-3-4-16-14(10)15/h8-13H,3-7H2,1-2H3.
What are the key properties of 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one?
3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one has a molecular weight of 222.33 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolan-2-one is sourced from PubChem (CID 20593703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).