C13H22N4O2 — CID 20593838
1,3-dimethyl-7-(4-methylpentyl)-4,5-dihydropurine-2,6-dione (PubChem CID 20593838) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,3-dimethyl-7-(4-methylpentyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(4-methylpentyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 20593838 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1,3-dimethyl-7-(4-methylpentyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CC(C)CCCN1C=NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H22N4O2/c1-9(2)6-5-7-17-8-14-11-10(17)12(18)16(4)13(19)15(11)3/h8-11H,5-7H2,1-4H3 |
| InChIKey | KTYFWWRJWVBYSR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |