C22H26FN5O3S — CID 20594104
ethoxy-[4-[2-(4-fluorophenyl)-1-(2-methylsulfinylpyrimidin-4-yl)imidazol-4-yl]piperidin-1-yl]methanol (PubChem CID 20594104) has the molecular formula C22H26FN5O3S and a molecular weight of 459.55 g/mol. Its IUPAC name is ethoxy-[4-[2-(4-fluorophenyl)-1-(2-methylsulfinylpyrimidin-4-yl)imidazol-4-yl]piperidin-1-yl]methanol.
| Compound Name | ethoxy-[4-[2-(4-fluorophenyl)-1-(2-methylsulfinylpyrimidin-4-yl)imidazol-4-yl]piperidin-1-yl]methanol |
|---|---|
| PubChem CID | 20594104 |
| Molecular Formula | C22H26FN5O3S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | ethoxy-[4-[2-(4-fluorophenyl)-1-(2-methylsulfinylpyrimidin-4-yl)imidazol-4-yl]piperidin-1-yl]methanol |
| SMILES | CCOC(O)N1CCC(c2cn(-c3ccnc(S(C)=O)n3)c(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C22H26FN5O3S/c1-3-31-22(29)27-12-9-15(10-13-27)18-14-28(19-8-11-24-21(26-19)32(2)30)20(25-18)16-4-6-17(23)7-5-16/h4-8,11,14-15,22,29H,3,9-10,12-13H2,1-2H3 |
| InChIKey | QXVMRZXXNQSAEA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|