C21H28N2O9S — CID 20594304
3-O-ethyl 2-O-methyl (3S,4aR,6S,8aR)-6-[(4-nitrophenyl)sulfonyloxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 20594304) has the molecular formula C21H28N2O9S and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl (3S,4aR,6S,8aR)-6-[(4-nitrophenyl)sulfonyloxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl (3S,4aR,6S,8aR)-6-[(4-nitrophenyl)sulfonyloxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 20594304 |
| Molecular Formula | C21H28N2O9S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-O-ethyl 2-O-methyl (3S,4aR,6S,8aR)-6-[(4-nitrophenyl)sulfonyloxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]2C[C@@H](COS(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC[C@H]2CN1C(=O)OC |
| InChI | InChI=1S/C21H28N2O9S/c1-3-31-20(24)19-11-16-10-14(4-5-15(16)12-22(19)21(25)30-2)13-32-33(28,29)18-8-6-17(7-9-18)23(26)27/h6-9,14-16,19H,3-5,10-13H2,1-2H3/t14-,15-,16+,19-/m0/s1 |
| InChIKey | BDPYMOHVHZYOMR-GGXPGOJBSA-N |
| XLogP | 2.74 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|