C32H14F6N2O12S2 — CID 20594919
[6-[3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oxyphenoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 20594919) has the molecular formula C32H14F6N2O12S2 and a molecular weight of 796.59 g/mol. Its IUPAC name is [6-[3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oxyphenoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-[3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oxyphenoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 20594919 |
| Molecular Formula | C32H14F6N2O12S2 |
| Molecular Weight | 796.59 g/mol |
| Exact Mass | 795.99 |
| IUPAC Name | [6-[3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]oxyphenoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2cccc3c(Oc4cccc(Oc5ccc6c7c(cccc57)C(=O)N(OS(=O)(=O)C(F)(F)F)C6=O)c4)ccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C32H14F6N2O12S2/c33-31(34,35)53(45,46)51-39-27(41)19-8-2-6-17-23(12-10-21(25(17)19)29(39)43)49-15-4-1-5-16(14-15)50-24-13-11-22-26-18(24)7-3-9-20(26)28(42)40(30(22)44)52-54(47,48)32(36,37)38/h1-14H |
| InChIKey | PGVDEGKFTVIPMB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|