C36H39N2+ — CID 20594929
2-[(E,3Z)-3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium (PubChem CID 20594929) has the molecular formula C36H39N2+ and a molecular weight of 499.72 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E,3Z)-3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 20594929 |
| Molecular Formula | C36H39N2+ |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 2-[(E,3Z)-3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
| SMILES | CCCCN1/C(=C\C=C\C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C36H39N2/c1-7-8-24-38-30-23-21-26-15-10-12-17-28(26)34(30)36(4,5)32(38)19-13-18-31-35(2,3)33-27-16-11-9-14-25(27)20-22-29(33)37(31)6/h9-23H,7-8,24H2,1-6H3/q+1 |
| InChIKey | HUQUTQWIPHIGOJ-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|