C25H21ClN2O4S2 — CID 20595060
3-[(2Z)-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate (PubChem CID 20595060) has the molecular formula C25H21ClN2O4S2 and a molecular weight of 513.04 g/mol. Its IUPAC name is 3-[(2Z)-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[(2Z)-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20595060 |
| Molecular Formula | C25H21ClN2O4S2 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 3-[(2Z)-2-[(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
| SMILES | C[n+]1c(/C=C2\Oc3ccc(-c4ccccc4)cc3N2CCCS(=O)(=O)[O-])sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H21ClN2O4S2/c1-27-21-15-19(26)9-11-23(21)33-25(27)16-24-28(12-5-13-34(29,30)31)20-14-18(8-10-22(20)32-24)17-6-3-2-4-7-17/h2-4,6-11,14-16H,5,12-13H2,1H3 |
| InChIKey | SYXSQRJPWBGWBL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|