C16H10FNO4S — CID 2059539
4-(4-fluorophenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 2059539) has the molecular formula C16H10FNO4S and a molecular weight of 331.32 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 2059539 |
| Molecular Formula | C16H10FNO4S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 4-(4-fluorophenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(F)cc2)c1C(=O)O)c1ccco1 |
| InChI | InChI=1S/C16H10FNO4S/c17-10-5-3-9(4-6-10)11-8-23-15(13(11)16(20)21)18-14(19)12-2-1-7-22-12/h1-8H,(H,18,19)(H,20,21) |
| InChIKey | YBUUIBNBZXTVJK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|