C20H17F2N5O6 — CID 20595448
2-(fluoromethoxyamino)-2-[2-[5-fluoro-6-(2-nitrophenoxy)pyrimidin-4-yl]oxyphenyl]-N-methylacetamide (PubChem CID 20595448) has the molecular formula C20H17F2N5O6 and a molecular weight of 461.38 g/mol. Its IUPAC name is 2-(fluoromethoxyamino)-2-[2-[5-fluoro-6-(2-nitrophenoxy)pyrimidin-4-yl]oxyphenyl]-N-methylacetamide.
| Compound Name | 2-(fluoromethoxyamino)-2-[2-[5-fluoro-6-(2-nitrophenoxy)pyrimidin-4-yl]oxyphenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 20595448 |
| Molecular Formula | C20H17F2N5O6 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 2-(fluoromethoxyamino)-2-[2-[5-fluoro-6-(2-nitrophenoxy)pyrimidin-4-yl]oxyphenyl]-N-methylacetamide |
| SMILES | CNC(=O)C(NOCF)c1ccccc1Oc1ncnc(Oc2ccccc2[N+](=O)[O-])c1F |
| InChI | InChI=1S/C20H17F2N5O6/c1-23-18(28)17(26-31-10-21)12-6-2-4-8-14(12)32-19-16(22)20(25-11-24-19)33-15-9-5-3-7-13(15)27(29)30/h2-9,11,17,26H,10H2,1H3,(H,23,28) |
| InChIKey | YJXUSPGBIXETTN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|