About [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol
[6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol (PubChem CID 20596521) has the molecular formula C18H12F4N2O
and a molecular weight of 348.30 g/mol. Its IUPAC name is [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol |
| PubChem CID | 20596521 |
| Molecular Formula | C18H12F4N2O |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(Nc2c(F)cccc2F)nc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C18H12F4N2O/c19-11-5-6-12(15(22)8-11)17-10(9-25)4-7-16(23-17)24-18-13(20)2-1-3-14(18)21/h1-8,25H,9H2,(H,23,24) |
| InChIKey | NFHGYLPJFQQXDV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol?
The IUPAC name of [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol (CID 20596521) is [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol.
What is the SMILES notation for [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol?
The canonical SMILES for [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol is OCc1ccc(Nc2c(F)cccc2F)nc1-c1ccc(F)cc1F.
What is the InChIKey of [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol?
The InChIKey is NFHGYLPJFQQXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F4N2O/c19-11-5-6-12(15(22)8-11)17-10(9-25)4-7-16(23-17)24-18-13(20)2-1-3-14(18)21/h1-8,25H,9H2,(H,23,24).
What are the key properties of [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol?
[6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol has a molecular weight of 348.30 g/mol, XLogP of 4.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methanol is sourced from PubChem (CID 20596521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).