C20H23NO2 — CID 20596642
2-(2-ethyl-4,5-dihydro-1,3-oxazol-4-yl)-1,3-diphenylpropan-2-ol (PubChem CID 20596642) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(2-ethyl-4,5-dihydro-1,3-oxazol-4-yl)-1,3-diphenylpropan-2-ol.
| Compound Name | 2-(2-ethyl-4,5-dihydro-1,3-oxazol-4-yl)-1,3-diphenylpropan-2-ol |
|---|---|
| PubChem CID | 20596642 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(2-ethyl-4,5-dihydro-1,3-oxazol-4-yl)-1,3-diphenylpropan-2-ol |
| SMILES | CCC1=NC(C(O)(Cc2ccccc2)Cc2ccccc2)CO1 |
| InChI | InChI=1S/C20H23NO2/c1-2-19-21-18(15-23-19)20(22,13-16-9-5-3-6-10-16)14-17-11-7-4-8-12-17/h3-12,18,22H,2,13-15H2,1H3 |
| InChIKey | TZGMGUADIAHOIE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |