About actinium;3,4-dihydroxybenzaldehyde
actinium;3,4-dihydroxybenzaldehyde (PubChem CID 20596648) has the molecular formula C7H6Ac2O3
and a molecular weight of 592.12 g/mol. Its IUPAC name is actinium;3,4-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | actinium;3,4-dihydroxybenzaldehyde |
| PubChem CID | 20596648 |
| Molecular Formula | C7H6Ac2O3 |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | actinium;3,4-dihydroxybenzaldehyde |
| SMILES | O=Cc1ccc(O)c(O)c1.[Ac].[Ac] |
| InChI | InChI=1S/C7H6O3.2Ac/c8-4-5-1-2-6(9)7(10)3-5;;/h1-4,9-10H;; |
| InChIKey | FDYLRIKGQDAOCH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze actinium;3,4-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;3,4-dihydroxybenzaldehyde?
The IUPAC name of actinium;3,4-dihydroxybenzaldehyde (CID 20596648) is actinium;3,4-dihydroxybenzaldehyde.
What is the SMILES notation for actinium;3,4-dihydroxybenzaldehyde?
The canonical SMILES for actinium;3,4-dihydroxybenzaldehyde is O=Cc1ccc(O)c(O)c1.[Ac].[Ac].
What is the InChIKey of actinium;3,4-dihydroxybenzaldehyde?
The InChIKey is FDYLRIKGQDAOCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.2Ac/c8-4-5-1-2-6(9)7(10)3-5;;/h1-4,9-10H;;.
What are the key properties of actinium;3,4-dihydroxybenzaldehyde?
actinium;3,4-dihydroxybenzaldehyde has a molecular weight of 592.12 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;3,4-dihydroxybenzaldehyde is sourced from PubChem (CID 20596648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).