About bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium
bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium (PubChem CID 20596808) has the molecular formula C8H24N6Pd-2
and a molecular weight of 310.74 g/mol. Its IUPAC name is bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium.
Molecular Properties
| Compound Name | bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium |
| PubChem CID | 20596808 |
| Molecular Formula | C8H24N6Pd-2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium |
| SMILES | [NH-]CC[N-]CC[NH3+].[NH-]CC[N-]CC[NH3+].[Pd] |
| InChI | InChI=1S/2C4H11N3.Pd/c2*5-1-3-7-4-2-6;/h2*5H,1-4,6H2;/q2*-2;/p+2 |
| InChIKey | UNMCXBAEDJYOSC-UHFFFAOYSA-P |
| XLogP | -0.69 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium?
The IUPAC name of bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium (CID 20596808) is bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium.
What is the SMILES notation for bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium?
The canonical SMILES for bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium is [NH-]CC[N-]CC[NH3+].[NH-]CC[N-]CC[NH3+].[Pd].
What is the InChIKey of bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium?
The InChIKey is UNMCXBAEDJYOSC-UHFFFAOYSA-P. The full InChI is InChI=1S/2C4H11N3.Pd/c2*5-1-3-7-4-2-6;/h2*5H,1-4,6H2;/q2*-2;/p+2.
What are the key properties of bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium?
bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium has a molecular weight of 310.74 g/mol, XLogP of -0.69, 8 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-azanidylethyl(2-azaniumylethyl)azanide);palladium is sourced from PubChem (CID 20596808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).