About bis(2-azanidylethyl(methyl)azanide);palladium
bis(2-azanidylethyl(methyl)azanide);palladium (PubChem CID 20596854) has the molecular formula C6H16N4Pd-4
and a molecular weight of 250.64 g/mol. Its IUPAC name is bis(2-azanidylethyl(methyl)azanide);palladium.
Molecular Properties
| Compound Name | bis(2-azanidylethyl(methyl)azanide);palladium |
| PubChem CID | 20596854 |
| Molecular Formula | C6H16N4Pd-4 |
| Molecular Weight | 250.64 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | bis(2-azanidylethyl(methyl)azanide);palladium |
| SMILES | C[N-]CC[NH-].C[N-]CC[NH-].[Pd] |
| InChI | InChI=1S/2C3H8N2.Pd/c2*1-5-3-2-4;/h2*4H,2-3H2,1H3;/q2*-2; |
| InChIKey | UJISKQFZTFJDOS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(2-azanidylethyl(methyl)azanide);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-azanidylethyl(methyl)azanide);palladium?
The IUPAC name of bis(2-azanidylethyl(methyl)azanide);palladium (CID 20596854) is bis(2-azanidylethyl(methyl)azanide);palladium.
What is the SMILES notation for bis(2-azanidylethyl(methyl)azanide);palladium?
The canonical SMILES for bis(2-azanidylethyl(methyl)azanide);palladium is C[N-]CC[NH-].C[N-]CC[NH-].[Pd].
What is the InChIKey of bis(2-azanidylethyl(methyl)azanide);palladium?
The InChIKey is UJISKQFZTFJDOS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H8N2.Pd/c2*1-5-3-2-4;/h2*4H,2-3H2,1H3;/q2*-2;.
What are the key properties of bis(2-azanidylethyl(methyl)azanide);palladium?
bis(2-azanidylethyl(methyl)azanide);palladium has a molecular weight of 250.64 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-azanidylethyl(methyl)azanide);palladium is sourced from PubChem (CID 20596854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).