C25H23N3O3 — CID 20597176
ethyl 3-[(Z)-(2-oxo-4-pyridin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate (PubChem CID 20597176) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is ethyl 3-[(Z)-(2-oxo-4-pyridin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate.
| Compound Name | ethyl 3-[(Z)-(2-oxo-4-pyridin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 20597176 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | ethyl 3-[(Z)-(2-oxo-4-pyridin-4-yl-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(/C=C2\C(=O)Nc3cccc(-c4ccncc4)c32)c2c1CCCC2 |
| InChI | InChI=1S/C25H23N3O3/c1-2-31-25(30)23-18-7-4-3-6-17(18)21(27-23)14-19-22-16(15-10-12-26-13-11-15)8-5-9-20(22)28-24(19)29/h5,8-14,27H,2-4,6-7H2,1H3,(H,28,29)/b19-14- |
| InChIKey | ZMKZMQUTDHJSGM-RGEXLXHISA-N |
| XLogP | 4.62 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|