About (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one
(E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one (PubChem CID 20597830) has the molecular formula C28H52O2
and a molecular weight of 420.72 g/mol. Its IUPAC name is (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one.
Molecular Properties
| Compound Name | (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one |
| PubChem CID | 20597830 |
| Molecular Formula | C28H52O2 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.40 |
| IUPAC Name | (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)CCC(C)C1OCC(C)C1C |
| InChI | InChI=1S/C28H52O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27(29)22-21-24(2)28-26(4)25(3)23-30-28/h12-13,24-26,28H,5-11,14-23H2,1-4H3/b13-12+ |
| InChIKey | QLALAZJYABLNMX-OUKQBFOZSA-N |
| XLogP | 8.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one?
The IUPAC name of (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one (CID 20597830) is (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one.
What is the SMILES notation for (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one?
The canonical SMILES for (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one is CCCCCCCC/C=C/CCCCCCCC(=O)CCC(C)C1OCC(C)C1C.
What is the InChIKey of (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one?
The InChIKey is QLALAZJYABLNMX-OUKQBFOZSA-N. The full InChI is InChI=1S/C28H52O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27(29)22-21-24(2)28-26(4)25(3)23-30-28/h12-13,24-26,28H,5-11,14-23H2,1-4H3/b13-12+.
What are the key properties of (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one?
(E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one has a molecular weight of 420.72 g/mol, XLogP of 8.68, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(3,4-dimethyloxolan-2-yl)docos-13-en-5-one is sourced from PubChem (CID 20597830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).