C21H20N4O2 — CID 20597845
2-[[3-[3-(1H-1,2,4-triazol-5-yl)propoxy]phenoxy]methyl]quinoline (PubChem CID 20597845) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[[3-[3-(1H-1,2,4-triazol-5-yl)propoxy]phenoxy]methyl]quinoline.
| Compound Name | 2-[[3-[3-(1H-1,2,4-triazol-5-yl)propoxy]phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 20597845 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[[3-[3-(1H-1,2,4-triazol-5-yl)propoxy]phenoxy]methyl]quinoline |
| SMILES | c1cc(OCCCc2ncn[nH]2)cc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H20N4O2/c1-2-8-20-16(5-1)10-11-17(24-20)14-27-19-7-3-6-18(13-19)26-12-4-9-21-22-15-23-25-21/h1-3,5-8,10-11,13,15H,4,9,12,14H2,(H,22,23,25) |
| InChIKey | ARCXYBSZYWBPDT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|