C20H28O — CID 20598217
5-(1,4a,5-trimethyl-2-methylidene-8aH-naphthalen-1-yl)-3-methylpent-1-en-3-ol (PubChem CID 20598217) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 5-(1,4a,5-trimethyl-2-methylidene-8aH-naphthalen-1-yl)-3-methylpent-1-en-3-ol.
| Compound Name | 5-(1,4a,5-trimethyl-2-methylidene-8aH-naphthalen-1-yl)-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 20598217 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 5-(1,4a,5-trimethyl-2-methylidene-8aH-naphthalen-1-yl)-3-methylpent-1-en-3-ol |
| SMILES | C=CC(C)(O)CCC1(C)C(=C)C=CC2(C)C(C)=CC=CC21 |
| InChI | InChI=1S/C20H28O/c1-7-18(4,21)13-14-20(6)16(3)11-12-19(5)15(2)9-8-10-17(19)20/h7-12,17,21H,1,3,13-14H2,2,4-6H3 |
| InChIKey | GODOWOXYNPKTTB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|