About 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one
2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one (PubChem CID 20598558) has the molecular formula C8H10INO2
and a molecular weight of 279.08 g/mol. Its IUPAC name is 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one.
Molecular Properties
| Compound Name | 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one |
| PubChem CID | 20598558 |
| Molecular Formula | C8H10INO2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one |
| SMILES | O=C1NC2CC3CC2C(O1)C3I |
| InChI | InChI=1S/C8H10INO2/c9-6-3-1-4-5(2-3)10-8(11)12-7(4)6/h3-7H,1-2H2,(H,10,11) |
| InChIKey | ZDCVYXDBHXOOKK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one?
The IUPAC name of 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one (CID 20598558) is 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one.
What is the SMILES notation for 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one?
The canonical SMILES for 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one is O=C1NC2CC3CC2C(O1)C3I.
What is the InChIKey of 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one?
The InChIKey is ZDCVYXDBHXOOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10INO2/c9-6-3-1-4-5(2-3)10-8(11)12-7(4)6/h3-7H,1-2H2,(H,10,11).
What are the key properties of 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one?
2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one has a molecular weight of 279.08 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-4-oxa-6-azatricyclo[5.2.1.03,8]decan-5-one is sourced from PubChem (CID 20598558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).